| Company Name: |
Shanghai Latchem Co., Ltd. Gold
|
| Tel: |
021-61916491 15921747686 |
| Email: |
sales@latcheminc.com |
| Products Intro: |
Product Name:Ethyl 2-(1,1-dioxidothietan-3-ylidene)acetate CAS:1394319-79-9 Package:1ASSAYS
|
| Company Name: |
SPIRO PHARMA
|
| Tel: |
|
| Email: |
eric_feng1954@126.com |
| Products Intro: |
Product Name:ethyl 2-(1,1-dioxidothietan-3-ylidene)acetate CAS:1394319-79-9 Purity:95% -98%HPLC Package:1GR;10GR;50GR;100GR;250GR;500GR;1KG;5KG;10KG;100KG
|
| Company Name: |
ShangHai Book Chemical Co., Ltd.
|
| Tel: |
15001988657 15802146997 |
| Email: |
info@bookchemicals.com |
| Products Intro: |
CAS:1394319-79-9 Package:10g/;100g/;1kg/;10kg/
|
|
| | Ethyl 2-(1,1-dioxidothietan-3-ylidene)acetate Basic information |
| | Ethyl 2-(1,1-dioxidothietan-3-ylidene)acetate Chemical Properties |
| Boiling point | 376.3±35.0 °C(Predicted) | | density | 1.449±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H10O4S/c1-2-11-7(8)3-6-4-12(9,10)5-6/h3H,2,4-5H2,1H3 | | InChIKey | YCHWXMHOXSFNCF-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)/C=C1\CS(=O)(=O)C\1 |
| | Ethyl 2-(1,1-dioxidothietan-3-ylidene)acetate Usage And Synthesis |
| | Ethyl 2-(1,1-dioxidothietan-3-ylidene)acetate Preparation Products And Raw materials |
|