|
|
| | Gold(1+), dichloro(1,10-phenanthroline-κN1,κN10)-, chloride (1:1), (SP-4-2)- Basic information |
| Product Name: | Gold(1+), dichloro(1,10-phenanthroline-κN1,κN10)-, chloride (1:1), (SP-4-2)- | | Synonyms: | Gold(1+), dichloro(1,10-phenanthroline-κN1,κN10)-, chloride (1:1), (SP-4-2)-;Gold(1+), dichloro(1,10-phenanthroline-κN1,κN10)-, chloride;Auphen;Dichloro(1,10-phenanthroline)gold chloride | | CAS: | 14910-99-7 | | MF: | C12H8AuCl3N2 | | MW: | 483.53 | | EINECS: | | | Product Categories: | | | Mol File: | 14910-99-7.mol |  |
| | Gold(1+), dichloro(1,10-phenanthroline-κN1,κN10)-, chloride (1:1), (SP-4-2)- Chemical Properties |
| InChI | InChI=1S/C12H8N2.Au.3ClH/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;;;/h1-8H;;3*1H/q;+3;;;/p-3 | | InChIKey | JAKVEVFPFMDQPF-UHFFFAOYSA-K | | SMILES | [Cl-][Au+3]1(N2=CC=CC3=CC=C4C=CC=N1C4=C23)[Cl-].[Cl-] |
| | Gold(1+), dichloro(1,10-phenanthroline-κN1,κN10)-, chloride (1:1), (SP-4-2)- Usage And Synthesis |
| | Gold(1+), dichloro(1,10-phenanthroline-κN1,κN10)-, chloride (1:1), (SP-4-2)- Preparation Products And Raw materials |
|