|
|
| | 2-aMino-3′,6′-bis(ethylaMino)-2′,7′-diMethylspiro〔isoindoline-1,9′-xanthen〕-3-one Basic information |
| Product Name: | 2-aMino-3′,6′-bis(ethylaMino)-2′,7′-diMethylspiro〔isoindoline-1,9′-xanthen〕-3-one | | Synonyms: | 2-aMino-3′,6′-bis(ethylaMino)-2′,7′-diMethylspiro〔isoindoline-1,9′-xanthen〕-3-one;rhodamine hydrazide;Spiro[1H-isoindole-1,9'-[9H]xanthen]-3(2H)-one, 2-amino-3',6'-bis(ethylamino)-2',7'-dimethyl- | | CAS: | 932013-08-6 | | MF: | C26H28N4O2 | | MW: | 428.53 | | EINECS: | | | Product Categories: | | | Mol File: | 932013-08-6.mol |  |
| | 2-aMino-3′,6′-bis(ethylaMino)-2′,7′-diMethylspiro〔isoindoline-1,9′-xanthen〕-3-one Chemical Properties |
| Boiling point | 623.4±65.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | 4.59±0.20(Predicted) | | form | Solid | | color | Off-white to pink | | InChI | InChI=1S/C26H28N4O2/c1-5-28-21-13-23-19(11-15(21)3)26(18-10-8-7-9-17(18)25(31)30(26)27)20-12-16(4)22(29-6-2)14-24(20)32-23/h7-14,28-29H,5-6,27H2,1-4H3 | | InChIKey | QUMMHDKUYXGXQJ-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(NCC)C(C)=C3)OC3=C1C=C(C)C(NCC)=C3)C1=C(C=CC=C1)C(=O)N2N |
| | 2-aMino-3′,6′-bis(ethylaMino)-2′,7′-diMethylspiro〔isoindoline-1,9′-xanthen〕-3-one Usage And Synthesis |
| Uses | Rhodamine 6G hydrazide (R6GH) is a fluorescent dye. Rhodamine 6G hydrazide can be used in selective colorimetric and fluorescent sensing[1]. | | References | [1] Upadhyay Y, et al. Optical sensing of hydrogen sulphate using rhodamine 6G hydrazide from aqueous medium. Spectrochim Acta A Mol Biomol Spectrosc. 2017 Jun 5;180:44-50. DOI:10.1016/j.saa.2017.02.057 |
| | 2-aMino-3′,6′-bis(ethylaMino)-2′,7′-diMethylspiro〔isoindoline-1,9′-xanthen〕-3-one Preparation Products And Raw materials |
|