2-ACETYL-1,3-CYCLOHEXANEDIONE manufacturers
|
| | 2-ACETYL-1,3-CYCLOHEXANEDIONE Basic information |
| | 2-ACETYL-1,3-CYCLOHEXANEDIONE Chemical Properties |
| Melting point | 20 °C (lit.) | | Boiling point | 85 °C/0.1 mmHg (lit.) | | density | 1.1690 (rough estimate) | | refractive index | 1.4787 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 3.50±0.25(Predicted) | | form | solid | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C8H10O3/c1-5(9)8-6(10)3-2-4-7(8)11/h8H,2-4H2,1H3 | | InChIKey | CHNXDYRMRBQOEF-UHFFFAOYSA-N | | SMILES | C1(=O)CCCC(=O)C1C(C)=O |
| WGK Germany | 3 | | HS Code | 2914290090 |
| | 2-ACETYL-1,3-CYCLOHEXANEDIONE Usage And Synthesis |
| Uses | The product has been used in the chelation of aqueous iron(III) th at is present in alcoholic drinks, such as wine and beer. It affects beer fermentation, stability and quality. It has also been used to evaluate mesotrione assay specificity as its structure is similar to mesotrione (a triketone herbicide). | | Synthesis Reference(s) | Synthesis, p. 925, 1978 DOI: 10.1055/s-1978-24943 |
| | 2-ACETYL-1,3-CYCLOHEXANEDIONE Preparation Products And Raw materials |
|