| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(E)-3-(tert-ButyldiMethylsilyloxy)propene-1-yl-boronic acid pinacol ester 97% manufacturers
|
| | (E)-3-(tert-ButyldiMethylsilyloxy)propene-1-yl-boronic acid pinacol ester 97% Basic information |
| Product Name: | (E)-3-(tert-ButyldiMethylsilyloxy)propene-1-yl-boronic acid pinacol ester 97% | | Synonyms: | (E)-3-(tert-ButyldiMethylsilyloxy)propene-1-yl-boronic acid pinacol ester 97%;tert-Butyldimethyl[[(2E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-yl]oxy]silane;3-(tert-butyldimethylsiloxy)prop-1-enylboronic acid pinacol ester;tert-butyl-dimethyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane;(E)-2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-[(1E)-3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-1-propenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-[(1E)-3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1-propen-1-yl]-4,4,5,5-tetramethyl-;(E)-3-(tert-ButyldiMethylsilyloxy)propene acid pinacolester | | CAS: | 114653-19-9 | | MF: | C15H31BO3Si | | MW: | 298.3 | | EINECS: | | | Product Categories: | | | Mol File: | 114653-19-9.mol |  |
| | (E)-3-(tert-ButyldiMethylsilyloxy)propene-1-yl-boronic acid pinacol ester 97% Chemical Properties |
| Boiling point | 297.2±42.0 °C(Predicted) | | density | 0.910 g/mL at 25 °C | | Fp | >110℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C15H31BO3Si/c1-13(2,3)20(8,9)17-12-10-11-16-18-14(4,5)15(6,7)19-16/h10-11H,12H2,1-9H3/b11-10+ | | InChIKey | LUURLZJMKOVITO-ZHACJKMWSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1/C=C/CO[Si](C(C)(C)C)(C)C |
| WGK Germany | 2 | | Storage Class | 10 - Combustible liquids |
| | (E)-3-(tert-ButyldiMethylsilyloxy)propene-1-yl-boronic acid pinacol ester 97% Usage And Synthesis |
| Uses | (E)-3-(tert-Butyldimethylsilyloxy)propene-1-yl-boronic acid pinacol ester can be used as a reactant in:
- Palladium-catalyzed Suzuki-Miyaura coupling reaction.
- The synthesis of anti-homoallylic alcohols by allylation reaction with aldehydes in the presence of iridium complex-catalyst.
- The preparation of α-imino aldehydes.
|
| | (E)-3-(tert-ButyldiMethylsilyloxy)propene-1-yl-boronic acid pinacol ester 97% Preparation Products And Raw materials |
|