|
|
| | ThuliuM(III) acetate hydrate 99.9% trace Metals basis Basic information |
| | ThuliuM(III) acetate hydrate 99.9% trace Metals basis Chemical Properties |
| form | powder | | InChI | 1S/3C2H4O2.H2O.Tm/c3*1-2(3)4;;/h3*1H3,(H,3,4);1H2;/q;;;;+3/p-3 | | InChIKey | GKCQSJXCECKBHO-UHFFFAOYSA-K | | SMILES | O.CC(=O)O[Tm](OC(C)=O)OC(C)=O |
| WGK Germany | 3 | | HS Code | 2915290000 | | Storage Class | 11 - Combustible Solids |
| | ThuliuM(III) acetate hydrate 99.9% trace Metals basis Usage And Synthesis |
| Uses | Thulium(III) acetate hydrate is a chemical compound containing the rare earth element thulium. It can be used as a precursor in the synthesis of core-shell nanocrystals. | | reaction suitability | core: thulium
reagent type: catalyst |
| | ThuliuM(III) acetate hydrate 99.9% trace Metals basis Preparation Products And Raw materials |
|