| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 2-AMino-4-broMo-5-Methoxy-benzoic acid Methyl ester Basic information |
| | 2-AMino-4-broMo-5-Methoxy-benzoic acid Methyl ester Chemical Properties |
| Boiling point | 358.8±37.0 °C(Predicted) | | density | 1.531±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 1.84±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C9H10BrNO3/c1-13-8-3-5(9(12)14-2)7(11)4-6(8)10/h3-4H,11H2,1-2H3 | | InChIKey | VLYQTTVQFZRGQX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(OC)=C(Br)C=C1N |
| | 2-AMino-4-broMo-5-Methoxy-benzoic acid Methyl ester Usage And Synthesis |
| | 2-AMino-4-broMo-5-Methoxy-benzoic acid Methyl ester Preparation Products And Raw materials |
|