|
|
| | (S)-1-(2-Bromo-phenyl)-ethylamine hydrochloride Basic information |
| Product Name: | (S)-1-(2-Bromo-phenyl)-ethylamine hydrochloride | | Synonyms: | (S)-1-(2-Bromo-phenyl)-ethylamine hydrochloride;(S)-1-(2-Bromophenyl)ethanamine hydrochloride;(S)-(-)-1-(2-Bromophenyl)ethylamine HCl;(1S)-1-(2-BROMOPHENYL)ETHAN-1-AMINE HYDROCHLORIDE;(S)-1-(2-bromophenyl)ethanamine HCl;(S)-1-(2-bromophenyl)ethan-1-amine hydrochloride | | CAS: | 1187931-26-5 | | MF: | C8H11BrClN | | MW: | 236.53664 | | EINECS: | | | Product Categories: | | | Mol File: | 1187931-26-5.mol |  |
| | (S)-1-(2-Bromo-phenyl)-ethylamine hydrochloride Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C8H10BrN.ClH/c1-6(10)7-4-2-3-5-8(7)9;/h2-6H,10H2,1H3;1H/t6-;/s3 | | InChIKey | MPTGUFFHOKLEFK-UZHXKHNSNA-N | | SMILES | N[C@H](C1=CC=CC=C1Br)C.[H]Cl |&1:1,r| |
| | (S)-1-(2-Bromo-phenyl)-ethylamine hydrochloride Usage And Synthesis |
| | (S)-1-(2-Bromo-phenyl)-ethylamine hydrochloride Preparation Products And Raw materials |
|