- 2-Acetamidoacrylic acid
-
- $0.00 / 25KG
-
2025-08-28
- CAS:5429-56-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
- 2-Acetamidoacrylic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:5429-56-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2-Acetamidoacrylic acid Basic information |
| Product Name: | 2-Acetamidoacrylic acid | | Synonyms: | 2-Propenoic acid,2-(acetylaMino)-;2-Acetamidoacrylic acid, N-Acetamidoacrylic acid;Acetyl-dehydro-Alanine≥ 99% (Titration);N-ACETYLDEHYDROALANINE;ACETYL-DEHYDROALANINE;AC-DEHYDRO-ALA-OH;2-(Acetylamino)-2-propenoic acid;2-ACETOMIDOACRYLIC ACID | | CAS: | 5429-56-1 | | MF: | C5H7NO3 | | MW: | 129.11 | | EINECS: | 226-583-3 | | Product Categories: | amino;monomer;Amino Acids & Derivatives | | Mol File: | 5429-56-1.mol |  |
| | 2-Acetamidoacrylic acid Chemical Properties |
| Melting point | 185-186 °C (dec.) (lit.) | | Boiling point | 239.15°C (rough estimate) | | density | 1.3816 (rough estimate) | | refractive index | 1.4220 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.53±0.11(Predicted) | | color | Off-White to Pale Grey | | Water Solubility | hardly soluble | | BRN | 1812032 | | InChI | InChI=1S/C5H7NO3/c1-3(5(8)9)6-4(2)7/h1H2,2H3,(H,6,7)(H,8,9) | | InChIKey | UFDFFEMHDKXMBG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(NC(C)=O)=C | | CAS DataBase Reference | 5429-56-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Propenoic acid, 2-(acetylamino)-(5429-56-1) |
| | 2-Acetamidoacrylic acid Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | An antioxidant. | | Uses | 2-Acetamidoacrylic acid is used as an antioxidant as well as a monomer. |
| | 2-Acetamidoacrylic acid Preparation Products And Raw materials |
|