| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
3-(2-Chloro-5-thiazolylmethyl)tetrahydro-5-methyl-d3-N-nitro-4H-1,3,5-oxadiazin-4-imine manufacturers
- Thiamethoxam-D3
-
- $106.00
-
2026-07-15
- CAS:1294048-82-0
- Purity:
- Supply Ability: 10g
|
| | 3-(2-Chloro-5-thiazolylmethyl)tetrahydro-5-methyl-d3-N-nitro-4H-1,3,5-oxadiazin-4-imine Basic information |
| | 3-(2-Chloro-5-thiazolylmethyl)tetrahydro-5-methyl-d3-N-nitro-4H-1,3,5-oxadiazin-4-imine Chemical Properties |
| Boiling point | 485.839±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.713±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Very Slightly) | | form | Solid | | pka | 0.990±0.10(predicted) | | color | White to off-white | | Major Application | agriculture
environmental | | InChI | 1S/C8H10ClN5O3S/c1-12-4-17-5-13(8(12)11-14(15)16)3-6-2-10-7(9)18-6/h2H,3-5H2,1H3/b11-8+/i1D3 | | InChIKey | NWWZPOKUUAIXIW-VZOBLPKOSA-N | | SMILES | [2H]C([2H])([2H])N1COCN(Cc2cnc(Cl)s2)\C1=N\[N+]([O-])=O | | EPA Substance Registry System | 3-(2-Chloro-5-thiazolylmethyl)tetrahydro-5-methyl-d3-N-nitro-4H-1,3,5-oxadiazin-4-imine (1294048-82-0) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Flam. Sol. 1
Repr. 2 |
| | 3-(2-Chloro-5-thiazolylmethyl)tetrahydro-5-methyl-d3-N-nitro-4H-1,3,5-oxadiazin-4-imine Usage And Synthesis |
| Uses | Thiamethoxam-d3 is deuterium labelled Thiamethoxam (T344180), which is a neonicotinoid insecticide. |
| | 3-(2-Chloro-5-thiazolylmethyl)tetrahydro-5-methyl-d3-N-nitro-4H-1,3,5-oxadiazin-4-imine Preparation Products And Raw materials |
|