| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| Product Name: | DPDCPB | | Synonyms: | 2-((7-(4-(Diphenylamino)phenyl)benzo[c][1,2,5]thiadiazol-4-yl)methylene)malononitrile;2-[7-(4-Diphenylaminophenyl)-2,1,3-benzothiadiazol-4-yl]methylenepropanedinitrile;DPDCPB;Propanedinitrile, 2-[[7-[4-(diphenylamino)phenyl]-2,1,3-benzothiadiazol-4-yl]methylene]-;2-[7-(4-Diphenylaminophenyl)-2,1,3-benzothiadiazol-4-yl]methylenepropanedinitrile 96% | | CAS: | 1393343-60-6 | | MF: | C28H17N5S | | MW: | 455.53 | | EINECS: | | | Product Categories: | | | Mol File: | 1393343-60-6.mol |  |
| | DPDCPB Chemical Properties |
| Melting point | 203-207°C | | form | solid | | semiconductor properties | P-type | | λmax | 549 nm in dichloromethane | | InChI | 1S/C28H17N5S/c29-18-20(19-30)17-22-13-16-26(28-27(22)31-34-32-28)21-11-14-25(15-12-21)33(23-7-3-1-4-8-23)24-9-5-2-6-10-24/h1-17H | | InChIKey | FWTUEQONZCDFRW-UHFFFAOYSA-N | | SMILES | N#CC(C#N)=CC1=CC=C(C2=CC=C(N(C3=CC=CC=C3)C4=CC=CC=C4)C=C2)C5=NSN=C15 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | DPDCPB Usage And Synthesis |
| Uses | A vacuum-deposited organic solar cell employing this novel donor-acceptor-acceptor (D-A-A) donor molecule; DPDCPB; combined with the electron acceptor C60/ C70 achieved a record-high power conversion efficiency (PCE) of 5.6%.
Device structure:
MoO3 (30nm) / DPDCPB (7nm) / DPDCPB:C70 (40nm) / C70 (7nm) / BCP (10nm) / Ag (150nm)
Device performance:
- JSC = 11.45 mA/cm2
- VOC = 1.0 V
- FF = 0.5
- PCE = 5.6%
|
| | DPDCPB Preparation Products And Raw materials |
|