|
|
| | 4-(2-cyanopropan-2-yl)benzoic acid Basic information |
| | 4-(2-cyanopropan-2-yl)benzoic acid Chemical Properties |
| Melting point | 172-178 °C | | Boiling point | 356.9±25.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 4.07±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C11H11NO2/c1-11(2,7-12)9-5-3-8(4-6-9)10(13)14/h3-6H,1-2H3,(H,13,14) | | InChIKey | MAVFXLXXHAMJTB-UHFFFAOYSA-N | | SMILES | CC(C)(C#N)c1ccc(cc1)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(2-cyanopropan-2-yl)benzoic acid Usage And Synthesis |
| | 4-(2-cyanopropan-2-yl)benzoic acid Preparation Products And Raw materials |
|