- 7-Ethyl tryptophol
-
- $0.00 / 1kg
-
2026-04-10
- CAS:41340-36-7
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 20tons
- 7-Ethyl tryptophol
-
- $0.00 / 25KG
-
2025-12-01
- CAS:41340-36-7
- Min. Order: 1KG
- Purity: 98
- Supply Ability: 10000KGS
- 7-Ethyl Tryptophol
-
- $5.00 / 1KG
-
2025-05-26
- CAS:41340-36-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | 7-Ethyl tryptophol Basic information |
| | 7-Ethyl tryptophol Chemical Properties |
| Melting point | 44-45°C | | Boiling point | 377.8±27.0 °C(Predicted) | | density | 1.146±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.98±0.10(Predicted) | | color | White to Pale Beige | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C12H15NO/c1-2-9-4-3-5-11-10(6-7-14)8-13-12(9)11/h3-5,8,13-14H,2,6-7H2,1H3 | | InChIKey | UVSDNCAZVSQJQA-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2CC)C(CCO)=C1 | | CAS DataBase Reference | 41340-36-7(CAS DataBase Reference) |
| Hazard Codes | Xn;N,N,Xn | | Risk Statements | 22-48/22-51/53 | | Safety Statements | 2-36/37/39-61 | | RIDADR | 3077 | | WGK Germany | WGK 2 | | RTECS | NL8512200 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
STOT RE 2 |
| | 7-Ethyl tryptophol Usage And Synthesis |
| Chemical Properties | Pale Beige Solid | | Uses | 7-Ethyltryptophol (Etodolac EP Impurity H) is a key intermediate in the preparation of the non-steroidal anti-inflammatory drug Etodolac. | | Uses | Key intermediate in the preparation of the non-steroidal anti-inflammatory drug Etodolac. |
| | 7-Ethyl tryptophol Preparation Products And Raw materials |
|