- 3-BROMOPROPIONAMIDE
-
- $1.10 / 1g
-
2025-11-18
- CAS:6320-96-3
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 3-BROMOPROPIONAMIDE Basic information |
| Product Name: | 3-BROMOPROPIONAMIDE | | Synonyms: | 3-BROMOPROPIONAMIDE;3-Bromopropanamide;bromopropionamide;Propanamide, 3-bromo-;3-BROMOPROPIONAMIDE 98+%;NSC 32255;(2E,4E,6E,8E,10E)-11-phenylundeca-2,4,6,8,10-pentaenal;3-Bromopropionamide > | | CAS: | 6320-96-3 | | MF: | C3H6BrNO | | MW: | 151.99 | | EINECS: | | | Product Categories: | | | Mol File: | 6320-96-3.mol |  |
| | 3-BROMOPROPIONAMIDE Chemical Properties |
| Melting point | 113°C | | Boiling point | 303.1±25.0 °C(Predicted) | | density | 1.651 | | storage temp. | 2-8°C | | form | powder to crystal | | pka | 15.95±0.40(Predicted) | | color | White to Almost white | | Water Solubility | almost transparency | | InChI | InChI=1S/C3H6BrNO/c4-2-1-3(5)6/h1-2H2,(H2,5,6) | | InChIKey | DBIVLAVBOICUQX-UHFFFAOYSA-N | | SMILES | C(N)(=O)CCBr | | CAS DataBase Reference | 6320-96-3 |
| Hazard Codes | Xn | | Risk Statements | 22-51 | | Safety Statements | 24/25 | | HS Code | 2924190090 |
| | 3-BROMOPROPIONAMIDE Usage And Synthesis |
| | 3-BROMOPROPIONAMIDE Preparation Products And Raw materials |
|