| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
(2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester manufacturers
|
| | (2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Basic information |
| Product Name: | (2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester | | Synonyms: | ((2R,3S)-3-((Benzyloxy)methyl)oxiran-2-yl)methyl 4-nitrobenzoate;(2R,3S)-(+)-4-BENZYLOXY-2,3-EPOXY-1-BUTYL 4-NITROBENZOATE;(+)-3-(BENZYLOXYMETHYL)OXIRANE-2-METHA-N OL 4-NITROBENZOATE;2-Oxiranemethanol, 3-[(phenylmethoxy)methyl]-, 2-(4-nitrobenzoate), (2R,3S)-;(2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester;(2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester | | CAS: | 78469-86-0 | | MF: | C18H17NO6 | | MW: | 343.34 | | EINECS: | | | Product Categories: | | | Mol File: | 78469-86-0.mol |  |
| | (2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Chemical Properties |
| Melting point | 78-80 °C | | Boiling point | 509.5±35.0 °C(Predicted) | | density | 1.299±0.06 g/cm3(Predicted) | | form | solid | | Optical Rotation | [α]20/D +34±1°, c =0.5% in chloroform | | InChI | 1S/C18H17NO6/c20-18(14-6-8-15(9-7-14)19(21)22)24-12-17-16(25-17)11-23-10-13-4-2-1-3-5-13/h1-9,16-17H,10-12H2/t16-,17+/m0/s1 | | InChIKey | XBAOYRZETQXAAE-DLBZAZTESA-N | | SMILES | [O-][N+](=O)c1ccc(cc1)C(=O)OC[C@H]2O[C@H]2COCc3ccccc3 | | CAS DataBase Reference | 78469-86-0 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Usage And Synthesis |
| | (2R,3S)-(+)-3-(Benzyloxymethyl)oxirane-2-methanol 4-nitrobenzoic acid ester Preparation Products And Raw materials |
|