- 2,3-DIMETHOXYBENZONITRILE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:5653-62-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2,3-DIMETHOXYBENZONITRILE Basic information |
| Product Name: | 2,3-DIMETHOXYBENZONITRILE | | Synonyms: | O-VERATRONITRILE;BENZONITRILE, 2,3-DIMETHOXY-;LABOTEST-BB LT00159775;2,3-DIMETHOXYBENZONITRILE;2-VERATRONITRILE;3,2-DIMETHOXYBENZONITRILE;3-CYANOVERATROLE;2,3-dimethoxy-benzonitril | | CAS: | 5653-62-3 | | MF: | C9H9NO2 | | MW: | 163.17 | | EINECS: | 227-097-4 | | Product Categories: | Aromatic Nitriles | | Mol File: | 5653-62-3.mol |  |
| | 2,3-DIMETHOXYBENZONITRILE Chemical Properties |
| Melting point | 43-46 °C(lit.) | | Boiling point | 265℃ | | density | 1.12 | | refractive index | 1.5300 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Insoluble in water. | | BRN | 2719631 | | Stability: | Stable. Incompatible with strong bases, strong acids, strong oxidizing agents. | | InChI | InChI=1S/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 | | InChIKey | LBXGBNHUNHWYRM-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC(OC)=C1OC | | CAS DataBase Reference | 5653-62-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | DI4355000 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 |
| | 2,3-DIMETHOXYBENZONITRILE Usage And Synthesis |
| Chemical Properties | white crystals | | Uses | It is employed in the replacement of nuclear alkoxyl groups to yield dimethoxy ketones by the action of methyl and phenyl Grignard reagents on 2,3-dimethoxybenzonitrile. |
| | 2,3-DIMETHOXYBENZONITRILE Preparation Products And Raw materials |
|