|
|
| | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one Basic information | | Uses |
| | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one Chemical Properties |
| Melting point | >252 °C (dec.) (lit.) | | density | 1.4456 (rough estimate) | | vapor pressure | 0.001Pa at 20℃ | | refractive index | 1.5650 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | pKa 4.90 (H2O
t = 37
I = 0.15) (Uncertain) | | form | Powder | | color | White to Orange to Green | | Water Solubility | 5 g/L (20 ºC) | | BRN | 619424 | | InChI | InChI=1S/C10H10N2O4S/c1-7-6-10(13)12(11-7)8-2-4-9(5-3-8)17(14,15)16/h2-5H,6H2,1H3,(H,14,15,16) | | InChIKey | CWJQQASJVVAXKL-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(N2C(=O)CC(C)=N2)C=C1 | | LogP | -2.04 at 23℃ and pH7 | | CAS DataBase Reference | 89-36-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 4-(4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)- (89-36-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29331990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one Usage And Synthesis |
| Uses | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one acts as a reagent for the identification of sulfonic acids as efficient ecto-5'-nucleotidase inhibitors. Ecto-5'-nucleotidase inhibition is thought to provide an attractive approach to cancer therapy. | | Chemical Properties | BEIGE POWDER | | Uses | 1-(4-Sulfophenyl)-3-methyl-5-pyrazolone (4-(3-methyl-5-oxo-2-pyrazolin-1-yl) benzoic acid) was used for pre-column derivatization of carbohydrates. It was also used as derivatization reagent in determination of oligosides, mannose and galactose obtained by degradation of galactomannans. | | Definition | ChEBI: 4-(3-Methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonic acid is an organosulfur compound and a sulfonic acid derivative. |
| | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one Preparation Products And Raw materials |
|