| Company Name: |
Shanghai Aladdin Bio-Chem Technology Co.,LTD
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:Magnesium ionophore III（ETH 4030）
CAS:119110-38-2
Purity:Moligand?, >=95% Package:1mg/RMB 899.90;10mg/RMB 2399.90;50mg/RMB 4899.90
|
|
| | ETH 4030 Basic information |
| Product Name: | ETH 4030 | | Synonyms: | N,N''-OCTAMETHYLENE-BIS(N'-HEPTYL-N'-METHYLMALONAMIDE);ETH 4030;Propanediamide,N1,N1'-1,8-octanediylbis[N3-heptyl-N3-methyl-;N'-heptyl-N-[8-[[3-[heptyl(methyl)amino]-3-oxopropanoyl]amino]octyl]-N'-methylpropanediamide;ETH 4030, N,Nμμ-Octamethylene-bis(Nμ-heptyl-Nμ-methylmalonamide);MagnesiuM Inophore III;MAGNESIUM IONOPHORE III;MAGNESIUM-IONOPHOR III | | CAS: | 119110-38-2 | | MF: | C30H58N4O4 | | MW: | 538.81 | | EINECS: | | | Product Categories: | | | Mol File: | 119110-38-2.mol |  |
| | ETH 4030 Chemical Properties |
| storage temp. | 2-8°C | | BRN | 6016307 | | InChI | 1S/C30H58N4O4/c1-5-7-9-15-19-23-33(3)29(37)25-27(35)31-21-17-13-11-12-14-18-22-32-28(36)26-30(38)34(4)24-20-16-10-8-6-2/h5-26H2,1-4H3,(H,31,35)(H,32,36) | | InChIKey | MXMJPDBVBJZBCA-UHFFFAOYSA-N | | SMILES | CCCCCCCN(C)C(=O)CC(=O)NCCCCCCCCNC(=O)CC(=O)N(C)CCCCCCC |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | ETH 4030 Usage And Synthesis |
| Uses | Magnesium ionophore III (ETH 4030) is an ionophore that has the activity of regulating the intracellular magnesium concentration. Magnesium ionophore III can promote the permeability of cell membranes to magnesium ions and enhance cell functions and metabolic activities. Magnesium ionophore III is also used to study the importance of magnesium ions in biological processes and its effects on cell physiology. |
| | ETH 4030 Preparation Products And Raw materials |
|