- Perfluorodecyl iodide
-
- $101.00 / 1KG
-
2025-09-25
- CAS:423-62-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- Perfluorodecyl iodide
-
- $0.00 / 1kg
-
2025-04-04
- CAS:423-62-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | Perfluorodecyl iodide Basic information |
| Product Name: | Perfluorodecyl iodide | | Synonyms: | Iodoperfluorodecane;henicosafluoro-10-iododecane;HENEICOSAFLUORO-N-DECYL IODIDE;1-IODOPERFLUORODECANE;PERFLUORODECYL IODIDE;PERFLUORO-N-DECYL IODIDE;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-10-iodo-decan;1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Henicosafluoro-10-iododecane | | CAS: | 423-62-1 | | MF: | C10F21I | | MW: | 645.98 | | EINECS: | 207-030-5 | | Product Categories: | Fluorous Chemistry;Fluorous Compounds;Synthetic Organic Chemistry;Alkyl;Halogenated Hydrocarbons;Organic Building Blocks | | Mol File: | 423-62-1.mol |  |
| | Perfluorodecyl iodide Chemical Properties |
| Melting point | 65-67 °C | | Boiling point | 195-200 °C | | density | 1.8 | | refractive index | 1.317 | | Fp | 195-200°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White | | Sensitive | Light Sensitive | | BRN | 1810506 | | Exposure limits | ACGIH: TWA 0.01 ppm | | InChI | 1S/C10F21I/c11-1(12,3(15,16)5(19,20)7(23,24)9(27,28)29)2(13,14)4(17,18)6(21,22)8(25,26)10(30,31)32 | | InChIKey | UDWBMXSQHOHKOI-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I | | CAS DataBase Reference | 423-62-1(CAS DataBase Reference) | | NIST Chemistry Reference | Perfluorodecyl iodide(423-62-1) | | EPA Substance Registry System | Decane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluoro-10-iodo- (423-62-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | RTECS | MD8710000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29033990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Perfluorodecyl iodide Usage And Synthesis |
| Chemical Properties | white to off-white transparent crystals or | | Uses | Perfluorodecyl iodide is used to prepare 3,5-bis(perfluorodecyl)phenylboronic acid, "green" catalyst for the direct amide condensation reaction. It is also used to synthesize 3-(perfluorodecyl)prop-1-ene. |
| | Perfluorodecyl iodide Preparation Products And Raw materials |
|