Dicyclohexyl-t-butylphosphonium tetrafluoroborate manufacturers
|
| | Dicyclohexyl-t-butylphosphonium tetrafluoroborate Basic information |
| | Dicyclohexyl-t-butylphosphonium tetrafluoroborate Chemical Properties |
| Melting point | 221-231 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C16H31P.BF4/c1-16(2,3)17(14-10-6-4-7-11-14)15-12-8-5-9-13-15;2-1(3,4)5/h14-15H,4-13H2,1-3H3;/q;-1/p+1 | | InChIKey | XOMLPCCNVCCMRG-UHFFFAOYSA-O | | SMILES | [PH+](C1CCCCC1)(C1CCCCC1)C(C)(C)C.[B-](F)(F)(F)F |
| RIDADR | UN1759 | | WGK Germany | WGK 3 | | HazardClass | 8 | | Storage Class | 11 - Combustible Solids |
| | Dicyclohexyl-t-butylphosphonium tetrafluoroborate Usage And Synthesis |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Dicyclohexyl-t-butylphosphonium tetrafluoroborate Preparation Products And Raw materials |
|