|
|
| | N-Methyl-1,2-benzenediamine dihydrochloride Basic information |
| | N-Methyl-1,2-benzenediamine dihydrochloride Chemical Properties |
| Melting point | 191°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Red to Light Beige | | Water Solubility | >=10 g/100 mL at 23 ºC | | InChI | InChI=1S/C7H10N2.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5,9H,8H2,1H3;1H | | InChIKey | IWRJMQUPCKSBFP-UHFFFAOYSA-N | | SMILES | N(C1C=CC=CC=1N)C.Cl | | CAS DataBase Reference | 25148-68-9(CAS DataBase Reference) | | EPA Substance Registry System | N-Methyl-o-phenylenediamine dihydrochloride (25148-68-9) |
| Safety Statements | 24/25 | | RIDADR | UN 2811 6.1/PG III | | TSCA | TSCA listed | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 29214400 |
| | N-Methyl-1,2-benzenediamine dihydrochloride Usage And Synthesis |
| Chemical Properties | Redish Powder | | Uses | N-Methyl-o-phenylenediamine, Dihydrochloride (cas# 25148-68-9) is a compound useful in organic synthesis. | | General Description | Crystals (from ethanol); light purple powder. | | Air & Water Reactions | Water soluble. | | Reactivity Profile | N-Methyl-1,2-benzenediamine dihydrochloride is an acidic salt. Materials in this group are generally soluble in water. The resulting solutions contain moderate concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. Many of these compounds catalyze organic reactions. | | Fire Hazard | Flash point data for N-Methyl-1,2-benzenediamine dihydrochloride are not available; however, N-Methyl-1,2-benzenediamine dihydrochloride is probably combustible. | | Synthesis | In a dry reaction flask, N-methylphthalimide was dissolved in methanol and then dilute aqueous hydrochloric acid was slowly added to the reaction flask and the resulting reaction mixture was stirred at room temperature for several hours. Directly after the reaction, the reaction mixture was concentrated under reduced pressure to remove the methanol solvent and water, and the resulting solid was the target product molecule N-methylphthalimide hydrochloride. |
| | N-Methyl-1,2-benzenediamine dihydrochloride Preparation Products And Raw materials |
|