|
|
| | 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride Basic information |
| | 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride Chemical Properties |
| Melting point | 198-203 °C(lit.) | | Boiling point | 147℃[at 101 325 Pa] | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | 3.9g/L at 28℃ | | InChI | InChI=1S/C13H18Cl2N2.ClH/c14-5-2-6-16-7-9-17(10-8-16)13-4-1-3-12(15)11-13;/h1,3-4,11H,2,5-10H2;1H | | InChIKey | JVLRNANYLVRULL-UHFFFAOYSA-N | | SMILES | ClC1=CC=CC(N2CCN(CCCCl)CC2)=C1.Cl | | LogP | 0.301 at 28℃ | | CAS DataBase Reference | 52605-52-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2933599550 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride is an arylpiperazine compound which is an important intermediate in the preparation of various pharmaceuticals, such as Trazodone (T718500), used to treat depression and post-traumatic stress. | | General Description | 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine monohydrochloride is present as impurity in nefazodone hydrochloride (pharmaceutical formulation). Synthesis of 1-(3-chlorophenyl)-4-(3-chloropropyl)piperazine monohydrochloride is reported. | | Flammability and Explosibility | Not classified |
| | 1-(3-Chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride Preparation Products And Raw materials |
|