|
| cis-Ethyl 4-hydroxycyclohexanecarboxylate Basic information |
Product Name: | cis-Ethyl 4-hydroxycyclohexanecarboxylate | Synonyms: | cis-Ethyl 4-hydroxycyclohexanecarboxylate;(1s,4s)-ethyl 4-hydroxycyclohexanecarboxylate;Cis-4-Hydroxy-cyclohexanecarboxylic acid ethyl ester;(2-BENZYLSULFANYLPHENYL)BORONIC ACID;Ethyl cis-4-hydroxycyclohexanecarboxylate;Cyclohexanecarboxylic acid, 4-hydroxy-, ethyl ester,cis-;ethyl cis-4-hydroxycyclohexanecarboxylate - [E87379] | CAS: | 75877-66-6 | MF: | C9H16O3 | MW: | 172.22 | EINECS: | | Product Categories: | | Mol File: | 75877-66-6.mol |  |
| cis-Ethyl 4-hydroxycyclohexanecarboxylate Chemical Properties |
Boiling point | 251.4±33.0 °C(Predicted) | density | 1.093±0.06 g/cm3(Predicted) | storage temp. | Storage temp. 2-8°C | pka | 14.98±0.40(Predicted) | Appearance | Light yellow to yellow Liquid | InChI | InChI=1S/C9H16O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7-8,10H,2-6H2,1H3/t7-,8+ | InChIKey | BZKQJSLASWRDNE-OCAPTIKFSA-N | SMILES | [C@@H]1(C(OCC)=O)CC[C@H](O)CC1 |
| cis-Ethyl 4-hydroxycyclohexanecarboxylate Usage And Synthesis |
| cis-Ethyl 4-hydroxycyclohexanecarboxylate Preparation Products And Raw materials |
|