|
|
| | Tetrazine amine HCl Salt Basic information |
| Product Name: | Tetrazine amine HCl Salt | | Synonyms: | Tetrazine-Amine;Tetrazine – Amine, HCl salt;4-(1,2,4,5-tetrazin-3-yl)benzenemethanamine hydrochloride;Benzenemethanamine, 4-(1,2,4,5-tetrazin-3-yl)-;Tetrazine - Amine - TFA-salt;4-(1,2,4,5-tetrazin-3-yl)benzenemethanamine;1-[4-(1,2,4,5-tetrazin-3-yl)phenyl]methanamine;3-(4-benzylamino)-1,2,4,5-tetrazine | | CAS: | 1092689-33-2 | | MF: | C9H9N5 | | MW: | 187.2 | | EINECS: | | | Product Categories: | SiChem | | Mol File: | 1092689-33-2.mol |  |
| | Tetrazine amine HCl Salt Chemical Properties |
| Boiling point | 403.4±47.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | pka | 8.31±0.10(Predicted) | | InChI | InChI=1S/C9H9N5/c10-5-7-1-3-8(4-2-7)9-13-11-6-12-14-9/h1-4,6H,5,10H2 | | InChIKey | JGCOJRPYFRRONJ-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(C2=NN=CN=N2)C=C1 |
| | Tetrazine amine HCl Salt Usage And Synthesis |
| Uses | Tetrazine-Amine is a tetrazine linker that can be used to covalently label live cells through a cycloaddition[1][2]. Tetrazine-Amine is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups. | | References | [1] Devaraj NK, et, al. Fast and sensitive pretargeted labeling of cancer cells through a tetrazine/trans-cyclooctene cycloaddition. Angew Chem Int Ed Engl. 2009;48(38):7013-6. DOI:10.1002/anie.200903233
[2] Devaraj NK, et, al. Tetrazine-based cycloadditions: application to pretargeted live cell imaging. Bioconjug Chem. 2008 Dec;19(12):2297-9. DOI:10.1021/bc8004446 |
| | Tetrazine amine HCl Salt Preparation Products And Raw materials |
|