199657-47-1 manufacturers
|
| | 199657-47-1 Basic information |
| Product Name: | 199657-47-1 | | Synonyms: | Givinostat Impurity 3;GivinostatImpurity3-d10;4-((((6-((diethylamino)methyl)naphthalen-2-yl)methoxy)carbonyl)amino)benzoic acid;Benzoic acid, 4-[[[[6-[(diethylamino)methyl]-2-naphthalenyl]methoxy]carbonyl]amino]-;4-[[[[6-[(Diethylamino)methyl]-2-naphthalenyl]methoxy]carbonyl]amino]benzoic acid;4-[[[[6-[(Diethylamino)methyl]-2-naphthalenylmethoxy]carbonyllaminolbenzoic acid;4-[[6-[(Diethylamino)methyl]-2-naphthalenyl]methoxy]carbonyllamino]benzcic acid | | CAS: | 199657-47-1 | | MF: | C24H26N2O4 | | MW: | 406.47 | | EINECS: | | | Product Categories: | | | Mol File: | 199657-47-1.mol |  |
| | 199657-47-1 Chemical Properties |
| Boiling point | 557.6±45.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | pka | 4.31±0.10(Predicted) | | InChI | InChI=1S/C24H26N2O4/c1-3-26(4-2)15-17-5-7-21-14-18(6-8-20(21)13-17)16-30-24(29)25-22-11-9-19(10-12-22)23(27)28/h5-14H,3-4,15-16H2,1-2H3,(H,25,29)(H,27,28) | | InChIKey | NCHVNKHIEHGHEU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(NC(OCC2=CC=C3C(=C2)C=CC(CN(CC)CC)=C3)=O)C=C1 |
| | 199657-47-1 Usage And Synthesis |
| | 199657-47-1 Preparation Products And Raw materials |
|