| Company Name: |
ZunaChem Pvt Ltd
|
| Tel: |
+91-7337409191 +91-7093354085 |
| Email: |
info@zunachem.com |
| Products Intro: |
Product Name:Fmoc-Cit-PAB-OH
CAS:870487-04-0
Purity:98% Package:1 kg,5 kg, 10 kg,25kg
|
| Company Name: |
SuZhou JianHua Pharmaceutical Co. Ltd Gold
|
| Tel: |
13666392288 |
| Email: |
jhyylcj@163.com |
| Products Intro: |
Product Name:Fmoc-Cit-PABA
CAS:870487-04-0
Purity:97% HPLC Package:1g/;10g/;50g/;1kg/
|
|
| | Fmoc-Cit-PABA Basic information |
| Product Name: | Fmoc-Cit-PABA | | Synonyms: | Fmoc-Cit-PABA;Fmoc-Cit-PAB-OH;Carbamic acid, N-[(1S)-4-[(aminocarbonyl)amino]-1-[[[4-(hydroxymethyl)phenyl]amino]carbonyl]butyl]-, 9H-fluoren-9-ylmethyl ester;(S)-(9H-Fluoren-9-yl)methyl [1-[[4-(Hydroxymethyl)phenyl]amino]-1-oxo-5-ureidopentan-2-yl]carbamate;Nalpha-Fmoc-L-citrulline (4-Hydroxymethyl)phenylamide;(9H-Fluoren-9-yl)methyl (S)-(1-((4-(hydroxymethyl)phenyl)amino)-1-oxo-5-ureidopentan-2-yl)carbamate;Fmoc-Cit- PAB;9H-Fluoren-9-ylmethyl?N-[(1S)-4-[(aminocarbonyl)amino]-1-[[[4-(hydroxymethyl)phenyl]amino]carbonyl]butyl]carbamate | | CAS: | 870487-04-0 | | MF: | C28H30N4O5 | | MW: | 502.56 | | EINECS: | | | Product Categories: | Linker;ADC;ADCs | | Mol File: | 870487-04-0.mol |  |
| | Fmoc-Cit-PABA Chemical Properties |
| Boiling point | 813.4±65.0 °C(Predicted) | | density | 1.315±0.06 g/cm3(Predicted) | | form | powder to crystal | | pka | 10.62±0.46(Predicted) | | color | White to Orange to Green | | InChIKey | KBTCNJJDJZRXCX-VWLOTQADSA-N | | SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)N[C@H](C(NC1=CC=C(CO)C=C1)=O)CCCNC(N)=O | | CAS DataBase Reference | 870487-04-0 |
| | Fmoc-Cit-PABA Usage And Synthesis |
| Uses | Fmoc-Cit-PAB-OH is a peptide linker containing an Fmoc-protected amine and citrulline residue. The Fmoc group can be deprotected under basic conditions to obtain the free amine, which can be used for further conjugations. |
| | Fmoc-Cit-PABA Preparation Products And Raw materials |
|