|
|
| | Cyclohexanecarboxylic acid, 3-hydroxy-, methyl ester, (1S,3R)-
Basic information |
| Product Name: | Cyclohexanecarboxylic acid, 3-hydroxy-, methyl ester, (1S,3R)-
| | Synonyms: | Cyclohexanecarboxylic acid, 3-hydroxy-, methyl ester, (1S,3R)-;Methyl (1S,3R)-3-Hydroxycyclohexanecarboxylate;methyl (1S,3R)-3-hydroxycyclohexane-1-carboxylate | | CAS: | 149055-86-7 | | MF: | C8H14O3 | | MW: | 158.2 | | EINECS: | | | Product Categories: | | | Mol File: | 149055-86-7.mol |  |
| | Cyclohexanecarboxylic acid, 3-hydroxy-, methyl ester, (1S,3R)-
Chemical Properties |
| Boiling point | 233.3±33.0 °C(Predicted) | | density | 1.121±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 14.90±0.40(Predicted) | | InChI | InChI=1S/C8H14O3/c1-11-8(10)6-3-2-4-7(9)5-6/h6-7,9H,2-5H2,1H3/t6-,7+/m0/s1 | | InChIKey | OXQRLBFDJMSRMM-NKWVEPMBSA-N | | SMILES | [C@H]1(C(OC)=O)CCC[C@@H](O)C1 |
| | Cyclohexanecarboxylic acid, 3-hydroxy-, methyl ester, (1S,3R)-
Usage And Synthesis |
| | Cyclohexanecarboxylic acid, 3-hydroxy-, methyl ester, (1S,3R)-
Preparation Products And Raw materials |
|