|
|
| | ISOPROPALIN Basic information |
| Product Name: | ISOPROPALIN | | Synonyms: | ISOPROPALIN PESTANAL (4-ISOPROPYL- 2,6-D;isopropaline;N-(4-Isopropyl-2,6-dinitrophenyl)-N,N-dipropylamine;Paarlan;Isopropalin 0;PAARLAN(R);ISOPROPALIN;EL-179 | | CAS: | 33820-53-0 | | MF: | C15H23N3O4 | | MW: | 309.36 | | EINECS: | 251-690-7 | | Product Categories: | | | Mol File: | 33820-53-0.mol |  |
| | ISOPROPALIN Chemical Properties |
| Boiling point | 449.64°C (rough estimate) | | density | 1.1220 (rough estimate) | | refractive index | 1.5600 (estimate) | | Fp | 40 °C | | storage temp. | 0-6°C | | form | Liquid | | pka | 1.27±0.50(Predicted) | | Water Solubility | 0.1mg/L(25 ºC) | | BRN | 2762577 | | InChI | 1S/C15H23N3O4/c1-5-7-16(8-6-2)15-13(17(19)20)9-12(11(3)4)10-14(15)18(21)22/h9-11H,5-8H2,1-4H3 | | InChIKey | NEKOXWSIMFDGMA-UHFFFAOYSA-N | | SMILES | CCCN(CCC)c1c(cc(cc1[N+]([O-])=O)C(C)C)[N+]([O-])=O | | EPA Substance Registry System | Isopropalin (33820-53-0) |
| Hazard Codes | N | | Risk Statements | 10-50/53 | | Safety Statements | 60-61 | | RIDADR | 1993 | | WGK Germany | 3 | | RTECS | BX9286000 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Flam. Liq. 3 | | Hazardous Substances Data | 33820-53-0(Hazardous Substances Data) |
| | ISOPROPALIN Usage And Synthesis |
| Uses | Herbicide. | | Definition | ChEBI: Isopropalin is a C-nitro compound. |
| | ISOPROPALIN Preparation Products And Raw materials |
|