| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(2R)-2-Hydroxy-3-methylbutyric acid manufacturers
|
| | (2R)-2-Hydroxy-3-methylbutyric acid Basic information |
| Product Name: | (2R)-2-Hydroxy-3-methylbutyric acid | | Synonyms: | (2R)-2-HYDROXY-3-METHYLBUTANOIC ACID;d-α-hydroxyisovaleric acid;D-ALPHA-HYDROXYSOVALERIC ACID);D-Valic acid;D-a-Hydroxyisovaleric acid;(2R)-2-Hydroxy-3-methylbutyric acid;(2R)-2-Hydroxyisovaleric acid;D-ALPHA-HYDROXYISOVALERIC ACID | | CAS: | 17407-56-6 | | MF: | C5H10O3 | | MW: | 118.13 | | EINECS: | | | Product Categories: | | | Mol File: | 17407-56-6.mol |  |
| | (2R)-2-Hydroxy-3-methylbutyric acid Chemical Properties |
| Melting point | 64-67 °C | | Boiling point | 237.6±13.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 3.87±0.16(Predicted) | | form | solid | | Appearance | Off-white to yellow Solid | | Optical Rotation | [α]20/D 17±1°, c = 1% in chloroform | | BRN | 1721139 | | InChI | InChI=1S/C5H10O3/c1-3(2)4(6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/t4-/m1/s1 | | InChIKey | NGEWQZIDQIYUNV-SCSAIBSYSA-N | | SMILES | C(O)(=O)[C@H](O)C(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 2915601990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (2R)-2-Hydroxy-3-methylbutyric acid Usage And Synthesis |
| Uses | D-α-Hydroxyisovaleric acid may be used in the preparation of biodegradable, optically active and isotactic poly(D-2-hydroxy-3-methylbutanoic acid). | | Definition | ChEBI: (R)-2-hydroxy-3-methylbutyric acid is the R-enantiomer of 2-hydroxy-3-methylbutyric acid. It is functionally related to a D-valine. It is a conjugate acid of a (R)-2-hydroxy-3-methylbutyrate. It is an enantiomer of a (S)-2-hydroxy-3-methylbutyric acid. |
| | (2R)-2-Hydroxy-3-methylbutyric acid Preparation Products And Raw materials |
|