- 2-Dibenzothiophenamine
-
- $2.20 / 100kg
-
2025-10-13
- CAS:7428-91-3
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
- 2-Dibenzothiophenamine
-
- $0.00 / 1KG
-
2025-07-02
- CAS:7428-91-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 150KG /month
|
| | 2-Dibenzothiophenamine Basic information |
| Product Name: | 2-Dibenzothiophenamine | | Synonyms: | 2-Dibenzothiophenamine;Dibenzo[b,d]thiophen-2-amine;NSC 170576;2-Aminodibenzothiophene;Dibenzothiophen-2-amine;dibenzenebenzo[b,d]thiophene-2-amine | | CAS: | 7428-91-3 | | MF: | C12H9NS | | MW: | 199.27 | | EINECS: | | | Product Categories: | | | Mol File: | 7428-91-3.mol |  |
| | 2-Dibenzothiophenamine Chemical Properties |
| Melting point | 133-135 °C(Solv: methanol (67-56-1)) | | Boiling point | 413.2±18.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | powder to crystal | | pka | 4.12±0.30(Predicted) | | color | Light yellow to Brown to Dark green | | InChI | InChI=1S/C12H9NS/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H,13H2 | | InChIKey | ICMMJWDNKMITSS-UHFFFAOYSA-N | | SMILES | C12=CC=C(N)C=C1C1=CC=CC=C1S2 | | CAS DataBase Reference | 7428-91-3 |
| | 2-Dibenzothiophenamine Usage And Synthesis |
| | 2-Dibenzothiophenamine Preparation Products And Raw materials |
|