|
|
| | Norfloxacin EP Impurity G Basic information |
| Product Name: | Norfloxacin EP Impurity G | | Synonyms: | Norfloxacin EP Impurity G;Norfloxacin Impurity 7(Norfloxacin EP Impurity G);1-ethyl-6-fluoro-7-(4-formylpiperazin-1-yl)-1,4-dihydro-4-oxoquinoline-3-carboxylic acid;Norfloxacin EP Imp G;Norfloxacin Impurity 7;1-Ethyl-6-fluoro-7-(4-formylpiperaz;3-Quinolinecarboxylic acid, 1-ethyl-6-fluoro-7-(4-formyl-1-piperazinyl)-1,4-dihydro-4-oxo-;Norfloxacin EP Impurity G (Norfloxacin N-Formyl Impurity) | | CAS: | 70459-04-0 | | MF: | C17H18FN3O4 | | MW: | 347.34 | | EINECS: | | | Product Categories: | impurity | | Mol File: | 70459-04-0.mol |  |
| | Norfloxacin EP Impurity G Chemical Properties |
| Melting point | 292-293 °C(Solv: methanol (67-56-1)) | | Boiling point | 622.1±55.0 °C(Predicted) | | density | 1.453±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | 0.16±0.20(Predicted) | | color | White to Pale Yellow | | Stability: | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | 1S/C17H18FN3O4/c1-2-20-9-12(17(24)25)16(23)11-7-13(18)15(8-14(11)20)21-5-3-19(10-22)4-6-21/h7-10H,2-6H2,1H3,(H,24,25) | | InChIKey | BFGDJPQDLMOZQQ-UHFFFAOYSA-N | | SMILES | O=C(C1=CN(CC)C2=C(C=C(F)C(N3CCN(C([H])=O)CC3)=C2)C1=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Norfloxacin EP Impurity G Usage And Synthesis |
| Uses | N-Formyl Norfloxacin is impurity G of Norfloxacin (N681000), which is a pefloxacin derivative that acts as a fluorinated quinolone antibacterial. | | Definition | ChEBI: N-Formylnorfloxacin is a member of quinolines. |
| | Norfloxacin EP Impurity G Preparation Products And Raw materials |
|