| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
|
| | 4,4,5,7-tetramethylchroman-2-one Basic information |
| Product Name: | 4,4,5,7-tetramethylchroman-2-one | | Synonyms: | 4,4,5,7-tetramethylchroman-2-one;4,4,5,7-tetramethylchroman-2-one（WS202977）;6-(methylthio)pyrimidin-4-amine;2H-1-Benzopyran-2-one, 3,4-dihydro-4,4,5,7-tetramethyl-;4,4,5,7-tetramethyl-2-chromanone;4,4,5,7-tetramethyltryptophan-2-one | | CAS: | 40662-14-4 | | MF: | C13H16O2 | | MW: | 204.26 | | EINECS: | | | Product Categories: | | | Mol File: | 40662-14-4.mol |  |
| | 4,4,5,7-tetramethylchroman-2-one Chemical Properties |
| Boiling point | 296.6±40.0 °C(Predicted) | | density | 1.048±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H16O2/c1-8-5-9(2)12-10(6-8)15-11(14)7-13(12,3)4/h5-6H,7H2,1-4H3 | | InChIKey | SZFAEJMEHIBRMS-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(C)=CC(C)=C2C(C)(C)C1 |
| | 4,4,5,7-tetramethylchroman-2-one Usage And Synthesis |
| | 4,4,5,7-tetramethylchroman-2-one Preparation Products And Raw materials |
|