|
|
| | 9-[2,5-Anhydro-4-C-(hydroxymethyl)-alpha-L-lyxofuranosyl]-9H-purin-6-amine Basic information |
| | 9-[2,5-Anhydro-4-C-(hydroxymethyl)-alpha-L-lyxofuranosyl]-9H-purin-6-amine Chemical Properties |
| Boiling point | 660.0±65.0 °C(Predicted) | | density | 2.14±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | pka | 12.98±0.60(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1/C11H13N5O4/c12-8-5-9(14-3-13-8)16(4-15-5)10-6-7(18)11(1-17,20-10)2-19-6/h3-4,6-7,10,17-18H,1-2H2,(H2,12,13,14)/t6-,7+,10-,11+/s3 | | InChIKey | GHKDRNDFVCEETA-MIRGOXCMNA-N | | SMILES | [C@@]12([H])[C@]([H])(O)[C@@](CO)(O[C@H]1N1C3=C(N=C1)C(N)=NC=N3)CO2 |&1:0,2,5,9,r| |
| | 9-[2,5-Anhydro-4-C-(hydroxymethyl)-alpha-L-lyxofuranosyl]-9H-purin-6-amine Usage And Synthesis |
| Uses | 2'-O,4'-C-Methyleneadenosine (LNA-A) is a locked nucleic acid (LNA) and is also an adenosine analog[1]. | | Biological Activity | 2'-O,4'-C-Methyleneadenosine (LNA-A) is a locked nucleic acid (LNA) and is also an adenosine analog[1]. | | References | [1]. Ravn J, et al. Design, synthesis, and biological evaluation of LNA nucleosides as adenosine A3 receptor ligands. Bioorg Med Chem. 2007 Aug 15;15(16):5440-7. |
| | 9-[2,5-Anhydro-4-C-(hydroxymethyl)-alpha-L-lyxofuranosyl]-9H-purin-6-amine Preparation Products And Raw materials |
|