N-acrylamidoacetaldehyde dimethyl acetal manufacturers
|
| | N-acrylamidoacetaldehyde dimethyl acetal Basic information |
| Product Name: | N-acrylamidoacetaldehyde dimethyl acetal | | Synonyms: | N-acrylamidoacetaldehyde dimethyl acetal;2-Propenamide, N-(2,2-dimethoxyethyl)-;SKL781;N - (2,2-dimethoxyethyl) -2-acrylamide;N-(2,2-Dimethoxyethyl)acrylamide;N-(2,2-Dimethoxyethyl)prop-2-enamide;N-acrylamidoacetaldehyde dimethyl acetal [NAAADA] | | CAS: | 49707-23-5 | | MF: | C7H13NO3 | | MW: | 159.18 | | EINECS: | 610-472-5 | | Product Categories: | | | Mol File: | 49707-23-5.mol |  |
| | N-acrylamidoacetaldehyde dimethyl acetal Chemical Properties |
| Boiling point | 179℃ at 101.3kPa | | density | 1.078 at 20℃ | | vapor pressure | 0.149Pa at 20℃ | | storage temp. | Amber Vial, Refrigerator, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Stability: | Light Sensitive | | InChI | InChI=1S/C7H13NO3/c1-4-6(9)8-5-7(10-2)11-3/h4,7H,1,5H2,2-3H3,(H,8,9) | | InChIKey | CMMYGCUEJWTBCG-UHFFFAOYSA-N | | SMILES | C(NCC(OC)OC)(=O)C=C | | LogP | -0.3 at 20℃ and pH5.3-7.2 | | Surface tension | 68mN/m at 1g/L and 20℃ |
| | N-acrylamidoacetaldehyde dimethyl acetal Usage And Synthesis |
| Uses | N-(2,2-dimethoxyethyl)prop-2-enamide is used in preparation of Dimethoxyethyl Acrylamide. |
| | N-acrylamidoacetaldehyde dimethyl acetal Preparation Products And Raw materials |
|