| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
2,5-Dibromo-3,4-difluorothiophene manufacturers
|
| | 2,5-Dibromo-3,4-difluorothiophene Basic information | | Application |
| Product Name: | 2,5-Dibromo-3,4-difluorothiophene | | Synonyms: | IN1782, 2,5-Dibromo-3,4-difluorothiophene;Thiophene, 2,5-dibromo-3,4-difluoro-;M8801;Th2F-2Br;2,5-Dibromo-3,4-difluorothiophene | | CAS: | 347838-15-7 | | MF: | C4Br2F2S | | MW: | 277.91 | | EINECS: | | | Product Categories: | | | Mol File: | 347838-15-7.mol |  |
| | 2,5-Dibromo-3,4-difluorothiophene Chemical Properties |
| Boiling point | 202.8±35.0 °C(Predicted) | | density | 2.321±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C4Br2F2S/c5-3-1(7)2(8)4(6)9-3 | | InChIKey | IJBMOFPYAHGVOS-UHFFFAOYSA-N | | SMILES | C1(Br)SC(Br)=C(F)C=1F |
| | 2,5-Dibromo-3,4-difluorothiophene Usage And Synthesis |
| Application | 2,5-Dibromo-3,4-difluorothiophene can be used as an organic synthesis intermediate and a pharmaceutical intermediate in laboratory research and development processes and in the synthesis of pharmaceutical chemicals. |
| | 2,5-Dibromo-3,4-difluorothiophene Preparation Products And Raw materials |
|