TAMRA azide, 5- isomer manufacturers
- 5-TAMRA azide
-
-
2025-06-07
- CAS:825651-66-9
- Min. Order: 1mg
- Purity: >96.00%
- Supply Ability: 1mg
|
| | TAMRA azide, 5- isomer Basic information |
| Product Name: | TAMRA azide, 5- isomer | | Synonyms: | TAMRA azide, 5- isomer;TAMRA azide 5-Carboxytetramethylrhodamine-azide;Xanthylium, 9-[4-[[(3-azidopropyl)amino]carbonyl]-2-carboxyphenyl]-3,6-bis(dimethylamino)-, inner salt | | CAS: | 825651-66-9 | | MF: | C28H28N6O4 | | MW: | 512.57 | | EINECS: | | | Product Categories: | | | Mol File: | 825651-66-9.mol |  |
| | TAMRA azide, 5- isomer Chemical Properties |
| solubility | Soluble in DMF, DMSO, alcohols | | form | Solid | | color | Brown to reddish brown | | Appearance | violet solid or solution | | InChIKey | XASWYZOPZJEQFF-UHFFFAOYSA-N | | SMILES | C(C1C=C(C(=O)NCCCN=[N+]=[N-])C=CC=1C1=C2C=CC(N(C)C)=CC2=[O+]C2C=C(N(C)C)C=CC1=2)(=O)[O-] |
| | TAMRA azide, 5- isomer Usage And Synthesis |
| Description | TAMRA azide, 5-isomer is a linker of TAMRA which is a xanthene dye with orange emission. The addition of the azide groups allows for it to be reacted with alkynes, DBCO and BCN for copper-catalyzed Click Chemistry. This dye comes in a 5- and 6-isomer. | | Uses | 5-TAMRA-Azide, is a Fluorescent dye, that can be used for various labeling applications in chemistry.(Abs/Em = 546/579 nm) | | Abs/Em Maxima | 541/567 nm | | Fluoresene quantum yield | 0.1 | | Extinction Coefficient | 84000 | | CF260 | 0.32 | | CF280 | 0.19 |
| | TAMRA azide, 5- isomer Preparation Products And Raw materials |
|