| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | Ethyl 3-amino-3-(2-tolyl)propanoate HCl Basic information |
| Product Name: | Ethyl 3-amino-3-(2-tolyl)propanoate HCl | | Synonyms: | Ethyl 3-amino-3-(2-tolyl)propanoate HCl;(S)-ethyl 3-amino-3-(o-tolyl)propanoate;ethyl 3-amino-3-(o-tolyl)propanoate;Ethyl 3-Amino-3-(2-tolyl)propanoate Hydrochloric Acid Salt;Benzenepropanoic acid, β-amino-2-methyl-, ethyl ester;ethyl 3-amino-3-(o-tolyl)propanoate hydrochloride | | CAS: | 21464-57-3 | | MF: | C12H17NO2 | | MW: | 207.27 | | EINECS: | | | Product Categories: | | | Mol File: | 21464-57-3.mol |  |
| | Ethyl 3-amino-3-(2-tolyl)propanoate HCl Chemical Properties |
| Boiling point | 318.2±30.0 °C(Predicted) | | density | 1.057±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 7.94±0.10(Predicted) | | form | solid | | InChI | 1S/C12H17NO2/c1-3-15-12(14)8-11(13)10-7-5-4-6-9(10)2/h4-7,11H,3,8,13H2,1-2H3 | | InChIKey | MPRYVFLHNZNJLM-UHFFFAOYSA-N | | SMILES | NC(C1=CC=CC=C1C)CC(OCC)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Ethyl 3-amino-3-(2-tolyl)propanoate HCl Usage And Synthesis |
| | Ethyl 3-amino-3-(2-tolyl)propanoate HCl Preparation Products And Raw materials |
|