| Company Name: |
Shanghai Daken Advanced Materials Co.,Ltd |
| Tel: |
+86-2158073036 |
| Email: |
info@dakenam.com |
| Products Intro: |
Product Name:(4R,4'R,5S,5'S)-2,2'-(Cyclopropane-1,1-diyl)bis(4,5-diphenyl-4,5-dihydrooxazole)
CAS:229184-96-7
Purity:99% Package:1KG,5KG,10KG
|
|
|
|
|
| Company Name: |
Shanghai Acmec Biochemical Technology Co., Ltd. |
| Tel: |
+86-18621343501; +undefined18621343501 |
| Email: |
product@acmec-e.com |
| Products Intro: |
Product Name:(4R,4'R,5S,5'S)-2,2'-(Cyclopropane-1,1-diyl)bis(4,5-diphenyl-4,5-dihydrooxazole)
CAS:229184-96-7
Purity:97% Package:250mg, 100mg, 1g
|
|
|
|
|
| Company Name: |
Taizhou Nanfeng Pharmaceutical Research Institute Gold
|
| Tel: |
nanfengdrug@163.com; 18616377689 |
| Email: |
nanfengdrug@163.com |
| Products Intro: |
Product Name:(4R,4'R,5S,5'S)-2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-Oxazole
CAS:229184-96-7
Purity:98%+ Package:1g；5g；10g；100g; 1kg
|
|
| | (4R,4'R,5S,5'S)-2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-Oxazole Basic information |
| Product Name: | (4R,4'R,5S,5'S)-2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-Oxazole | | Synonyms: | (4R,4'R,5S,5'S)-2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-Oxazole;(4R,4'R,5S,5'S)-2,2'-Cyclopropylidenebis[4,5-dihydro-4,5-
diphenyloxazole],99%e.e.;(4R,4'R,5S,5'S)-2,2'-Cyclopropylidenebis[4,5-dihydro-4,5-diphenyloxazole], 98%, (99% ee);Oxazole, 2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-, (4R,4'R,5S,5'S)- (9CI);(4R,4'R,5S,5'S)-2,2'-(Cyclopropane-1,1-diyl)bis(4,5-diphenyl-4,5-dihydrooxazole);Oxazole, 2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-,(4R,4'R,5S,5'S)-;(4R,4''R,5S,5''S)-2,2''-Cyclopropylidenebis[4,5-dihydro-4,5-diphenyloxazole];(4R,4′R,5S,5′S)-2,2′-Cyclopropylidenebis[4,5-dihydro-4,5-diphenyloxazole] | | CAS: | 229184-96-7 | | MF: | C33H28N2O2 | | MW: | 484.6 | | EINECS: | | | Product Categories: | | | Mol File: | 229184-96-7.mol |  |
| | (4R,4'R,5S,5'S)-2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-Oxazole Chemical Properties |
| Melting point | 163-165 °C | | Boiling point | 620.8±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 4.66±0.70(Predicted) | | form | powder | | Appearance | Off-white to light yellow Solid | | InChIKey | UAXGHJCFHMQPBJ-AUJRTDPGNA-N | | SMILES | C1(C2O[C@@H](C3C=CC=CC=3)[C@@H](C3C=CC=CC=3)N=2)(C2O[C@@H](C3C=CC=CC=3)[C@@H](C3C=CC=CC=3)N=2)CC1 |&1:3,10,20,27,r| |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (4R,4'R,5S,5'S)-2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-Oxazole Usage And Synthesis |
| Uses | (4R,4μR,5S,5μS)-2,2μ-Cyclopropylidenebis[4,5-dihydro-4,5-diphenyloxazole] is a bisoxazoline (BOX) ligand for asymmetric catalysis. The copper-ligand complex has been shown to catalyze reactions of symmetric diaziridines with enol diazo compounds. |
| | (4R,4'R,5S,5'S)-2,2'-cyclopropylidenebis[4,5-dihydro-4,5-diphenyl-Oxazole Preparation Products And Raw materials |
|