|
|
| | 2-Chloro-5-fluorobenzonitrile Basic information |
| | 2-Chloro-5-fluorobenzonitrile Chemical Properties |
| Melting point | 65 °C | | Boiling point | 228.7±20.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C7H3ClFN/c8-7-2-1-6(9)3-5(7)4-10/h1-3H | | InChIKey | HBTXAKDVIXNVHZ-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(F)=CC=C1Cl | | CAS DataBase Reference | 57381-56-3(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 20/21/22-36/38 | | Safety Statements | 26-36/37 | | RIDADR | UN3439 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 |
| | 2-Chloro-5-fluorobenzonitrile Usage And Synthesis |
| Chemical Properties | off-white crystalline |
| | 2-Chloro-5-fluorobenzonitrile Preparation Products And Raw materials |
|