| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 6-Chlorochromone-3-propionic acid Basic information |
| | 6-Chlorochromone-3-propionic acid Chemical Properties |
| Melting point | 178-182 °C | | Boiling point | 444.3±45.0 °C(Predicted) | | density | 1.437±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.35±0.10(Predicted) | | InChI | 1S/C12H9ClO4/c13-8-2-3-10-9(5-8)12(16)7(6-17-10)1-4-11(14)15/h2-3,5-6H,1,4H2,(H,14,15) | | InChIKey | YXTVVBLJYNPMJZ-UHFFFAOYSA-N | | SMILES | OC(=O)CCC1=COc2ccc(Cl)cc2C1=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-Chlorochromone-3-propionic acid Usage And Synthesis |
| | 6-Chlorochromone-3-propionic acid Preparation Products And Raw materials |
|