- D-(-)-Lyxose
-
- $0.00 / 10G
-
2026-02-03
- CAS:1114-34-7
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
- D-Lyxose
-
- $41.00 / 500mg
-
2026-02-01
- CAS:1114-34-7
- Min. Order:
- Purity: 99.35%
- Supply Ability: 10g
- D-LYXOSE
-
- $10.00 / 1KG
-
2026-01-30
- CAS:1114-34-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | D-LYXOSE Basic information |
| | D-LYXOSE Chemical Properties |
| Melting point | 108-112 °C(lit.) | | alpha | D20 +5.5° -14.0° (c = 0.82 in water) | | Boiling point | 191.65°C (rough estimate) | | density | 1.545 | | refractive index | 1.3920 (estimate) | | storage temp. | Refrigerator | | solubility | H2O: 50 mg/mL, clear, colorless | | pka | 12.46±0.20(Predicted) | | form | Crystalline Powder | | color | White to slightly yellow | | Optical Rotation | [α]25/D 13.8°, c = 4 in H2O | | Water Solubility | Water (Slightly) | | Sensitive | Hygroscopic | | Merck | 14,5641 | | BRN | 1723083 | | InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4+,5?/m1/s1 | | InChIKey | SRBFZHDQGSBBOR-AGQMPKSLSA-N | | SMILES | O[C@@H]1COC(O)[C@@H](O)[C@H]1O | | LogP | -2.390 (est) | | CAS DataBase Reference | 1114-34-7(CAS DataBase Reference) | | EPA Substance Registry System | D-Lyxose (1114-34-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36/37/39-26 | | WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | D-LYXOSE Usage And Synthesis |
| Chemical Properties | White to slightly yellow crystalline powder | | Uses | D-LYXOSE is a useful carbohydrate synthon. | | Uses | D-Lyxose is a C’-2 epimer of D-Xylose (X750750). It is a monosaccharide and a reducing carbohydrate present in maple syrup. It is used in molecular modeling calculations in the study of drug binding and recognition in relation to aldose reductase. |
| | D-LYXOSE Preparation Products And Raw materials |
|