|
|
| | Acetic acid,2-[2-(acetylamino)phenoxy]- Basic information |
| | Acetic acid,2-[2-(acetylamino)phenoxy]- Chemical Properties |
| Boiling point | 426.1±20.0 °C(Predicted) | | density | 1.326±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 3.16±0.10(Predicted) | | InChI | 1S/C10H11NO4/c1-7(12)11-8-4-2-3-5-9(8)15-6-10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14) | | InChIKey | FXAVGVSUKFCXDK-UHFFFAOYSA-N | | SMILES | O=C(C)NC1=CC=CC=C1OCC(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Acetic acid,2-[2-(acetylamino)phenoxy]- Usage And Synthesis |
| | Acetic acid,2-[2-(acetylamino)phenoxy]- Preparation Products And Raw materials |
|