- Silicone Oil
-
- $4.60 / 1KG
-
2025-05-26
- CAS:68083-14-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 5000kg
|
| | Dimethyl-diphenylpolysiloxane Basic information |
| | Dimethyl-diphenylpolysiloxane Chemical Properties |
| Melting point | -50 °C | | Boiling point | >140 °C0.002 mm Hg(lit.) | | density | 1.09 g/mL at 20 °C | | vapor density | >1 (vs air) | | vapor pressure | <5 mm Hg ( 25 °C) | | refractive index | n20/D 1.537 | | Fp | >230 °F | | storage temp. | no restrictions. | | form | Liquid | | color | Colorless | | Specific Gravity | 0.98 | | Water Solubility | Miscible with aliphatic, aromatic hydrocarbons, alcohol and chlorinated hydrocarbons. Immiscible with water, methanol and ethylene glycol. | | InChI | InChI=1S/C16H22O2Si2/c1-17-19(2,3)18-20(4,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,1-4H3 | | InChIKey | ARWRSWALIGRKQA-UHFFFAOYSA-N | | SMILES | [Si](OC)(C)(C)O[Si](C)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 68083-14-7 | | EPA Substance Registry System | Dimethyl diphenyl siloxanes and silicones (68083-14-7) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | VW3146875 | | Autoignition Temperature | 460 °C | | TSCA | TSCA listed | | HS Code | 3910 00 00 | | Storage Class | 10 - Combustible liquids | | Toxicity | LC50 inhalation in rat: 18gm/m3/1H |
| | Dimethyl-diphenylpolysiloxane Usage And Synthesis |
| Uses | silicon oil is a generic description usually referring to dimethicone. | | Uses | Silicone oil is used in high temperature open systems, closed systems and circulating, closed loop and heat transfer baths. It is used as a high temperature fluid for laboratory research apparatus and instruments. It is also used as a calibration media in temperature controlled baths. | | Hazard | Low toxicity by ingestion. A mild eye irritant. |
| | Dimethyl-diphenylpolysiloxane Preparation Products And Raw materials |
|