| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Creatine-d3 H2O CAS:284664-86-4 Remarks:CS-C-00864
|
CREATINE-(METHYL-D3) MONOHYDRATE manufacturers
- Creatine-d3 hydrate
-
- $189.00 / 1mg
-
2026-04-09
- CAS:284664-86-4
- Min. Order:
- Purity: 92.96%
- Supply Ability: 10g
|
| | CREATINE-(METHYL-D3) MONOHYDRATE Basic information |
| Product Name: | CREATINE-(METHYL-D3) MONOHYDRATE | | Synonyms: | CREATINE-D3 H2O (METHYL-D3);CREATINE-D3 HYDRATE;CREATINE-(METHYL-D3) MONOHYDRATE;4-Amidinosarcosine-methyl-d3 monohydrate;Creatine-d3 (methyl-d3) monohydrate;Creatine-D32O (methyl-D3);Creatine-d3 H2O;2-[carbamimidoyl(trideuteriomethyl)amino]acetic acid | | CAS: | 284664-86-4 | | MF: | C4H11N3O3 | | MW: | 149.15 | | EINECS: | | | Product Categories: | | | Mol File: | 284664-86-4.mol |  |
| | CREATINE-(METHYL-D3) MONOHYDRATE Chemical Properties |
| Melting point | 292 °C (dec.)(lit.) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Aqueous Acid, Water (Slightly, Heated) | | form | Solid | | color | White to Off-White | | InChI | 1S/C4H9N3O2.H2O/c1-7(4(5)6)2-3(8)9;/h2H2,1H3,(H3,5,6)(H,8,9);1H2/i1D3; | | InChIKey | MEJYXFHCRXAUIL-NIIDSAIPSA-N | | SMILES | [H]O[H].[2H]C([2H])([2H])N(CC(O)=O)C(N)=N |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | CREATINE-(METHYL-D3) MONOHYDRATE Usage And Synthesis |
| Uses | Creatine-(methyl-d3) Monohydrate is an isotopic analog of Creatine Monohydrate (6020-87-7), which is a nitrogenous organic acid that occurs naturally in vertebrates. Its main role is to facilitate recycling of Adenosine Triphosphate (ATP), the energy currency of the cell, primarily in muscle and brain tissue. |
| | CREATINE-(METHYL-D3) MONOHYDRATE Preparation Products And Raw materials |
|