|
|
| | N,N'-bis(1-methylethyl)methanimidamide Basic information |
| Product Name: | N,N'-bis(1-methylethyl)methanimidamide | | Synonyms: | N,N'-bis(1-methylethyl)methanimidamide;N,N'-BIS(1-METHYLETHYL)METHANIMIDAMIDE,MIN.98%;N,N'-Bis(1-methylethyl)methanimidamide, min. 98%;Methanimidamide, N,N’-bis(1-methylethyl)-.;N,N''-Bis(1-methylethyl)methanimidamide;N,N'-Bis(1-methylethyl)methanimidamide, min;N,N’-Diisopropylformimidamide;N,N’-Diisopropylformimidamide | | CAS: | 44843-38-1 | | MF: | C7H16N2 | | MW: | 128.22 | | EINECS: | 219-852-1 | | Product Categories: | | | Mol File: | 44843-38-1.mol |  |
| | N,N'-bis(1-methylethyl)methanimidamide Chemical Properties |
| Boiling point | 164.5±23.0 °C(Predicted) | | density | 0.84±0.1 g/cm3(Predicted) | | pka | 11.39±0.50(Predicted) | | form | Powder | | color | off-white | | InChI | InChI=1S/C7H16N2/c1-6(2)8-5-9-7(3)4/h5-7H,1-4H3,(H,8,9) | | InChIKey | UBLPVUXFDNIPIV-UHFFFAOYSA-N | | SMILES | C(NC(C)C)=NC(C)C |
| | N,N'-bis(1-methylethyl)methanimidamide Usage And Synthesis |
| Uses | N,N'- bis (1-methylethyl) formamide is an amide organic compound, which can be used as pharmaceutical intermediates. |
| | N,N'-bis(1-methylethyl)methanimidamide Preparation Products And Raw materials |
|