|
|
| | 4-Methylpyridine-3-boronic acid Basic information |
| | 4-Methylpyridine-3-boronic acid Chemical Properties |
| Boiling point | 327.4±44.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | Liquid | | pka | 4.08±0.58(Predicted) | | color | Clear colorless to pale yellow | | InChI | InChI=1S/C6H8BNO2/c1-5-2-3-8-4-6(5)7(9)10/h2-4,9-10H,1H3 | | InChIKey | ASXFMIDIRZPCGK-UHFFFAOYSA-N | | SMILES | B(C1=C(C)C=CN=C1)(O)O | | CAS DataBase Reference | 148546-82-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4-Methylpyridine-3-boronic acid Usage And Synthesis |
| Uses | 4-Methylpyridine-3-boronic Acid is used in preparation of pyridopyrimidinone derivatives as AHR antagonists useful in the treatment of diseases. |
| | 4-Methylpyridine-3-boronic acid Preparation Products And Raw materials |
|