|
|
| | (S)-1-Benzyl-3-N-Boc-aminopiperidine Basic information |
| Product Name: | (S)-1-Benzyl-3-N-Boc-aminopiperidine | | Synonyms: | (S)-tert-butyl 1-benzylpiperidin-3-ylcarbamate;tert-butyl N-[(3S)-1-benzylpiperidin-3-yl]carbaMate;(R)-(1-BENZYL-PIPERIDIN-3-YL)-CARBAMIC ACID TERT-BUTYL ESTER;(S)-3-(BOC-AMINO)-1-BENZYL-PIPERIDINE;(S)-1-Benzyl-3-N-Boc-aMinopiperidine/(S)-tert-butyl 1-benzylpiperidin-3-ylcarbaMate;Carbamic acid, [(3S)-1-(phenylmethyl)-3-piperidinyl]-, 1,1-dimethylethyl ester (9CI);Carbamic acid, N-[(3S)-1-(phenylmethyl)-3-piperidinyl]-, 1,1-dimethylethyl ester;Alogliptin Impurity 69 | | CAS: | 216854-24-9 | | MF: | C17H26N2O2 | | MW: | 290.4 | | EINECS: | | | Product Categories: | | | Mol File: | 216854-24-9.mol |  |
| | (S)-1-Benzyl-3-N-Boc-aminopiperidine Chemical Properties |
| Boiling point | 400.9±34.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.31±0.20(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C17H26N2O2/c1-17(2,3)21-16(20)18-15-10-7-11-19(13-15)12-14-8-5-4-6-9-14/h4-6,8-9,15H,7,10-13H2,1-3H3,(H,18,20)/t15-/m0/s1 | | InChIKey | IJLXSEZUQISPRL-HNNXBMFYSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1CCCN(CC2=CC=CC=C2)C1 |
| Safety Statements | 24/25 | | HS Code | 29333990 |
| | (S)-1-Benzyl-3-N-Boc-aminopiperidine Usage And Synthesis |
| | (S)-1-Benzyl-3-N-Boc-aminopiperidine Preparation Products And Raw materials |
|