|
|
| | DIACETOXYSCIRPENOL Basic information |
| Product Name: | DIACETOXYSCIRPENOL | | Synonyms: | DIACETOXYSCIRPENOL;4BETA, 15-DIACETOXY-3-ALPHA-HYDROXY-12,13 EPOXY-TRICHOTHEC-9-ENE;ANGUIDINE;NSC 141537;12,13-epoxy-4-beta,15-diacetoxy-3-alpha-hydroxy-trichothec-9-en;3-alpha-hydroxy-4-beta,15-diacetoxy-12,13-epoxytrichothec-9-ene;4,15-Diacetoxyscirpen-3-ol;ANG 66 | | CAS: | 2270-40-8 | | MF: | C19H26O7 | | MW: | 366.41 | | EINECS: | 218-873-3 | | Product Categories: | antibiotic | | Mol File: | 2270-40-8.mol |  |
| | DIACETOXYSCIRPENOL Chemical Properties |
| Melting point | 162-164℃ | | Boiling point | 407.62°C (rough estimate) | | density | 1.1821 (rough estimate) | | refractive index | 1.4790 (estimate) | | Fp | 2 °C | | storage temp. | 2-8°C | | solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:4): 0.2 mg/ml; DMSO: 30 mg/ml; Ethanol: 20 mg/ml | | pka | 13.40±0.70(Predicted) | | form | A crystalline solid | | color | Crystals from EtOAc | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | InChI=1/C19H26O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13-16,22H,5-6,8-9H2,1-4H3/t13-,14-,15-,16-,17?,18-,19?/s3 | | InChIKey | AUGQEEXBDZWUJY-UYOBWRNGNA-N | | SMILES | CC12[C@@H]([C@@H](O)[C@@]([H])(O[C@]3([H])C=C(C)CC[C@]13COC(=O)C)C12OC1)OC(=O)C |&1:2,3,5,8,15,r| |
| | DIACETOXYSCIRPENOL Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Diacetoxyscirpenolis is a trichothecene mycotoxin produced by various Fusarium strains. Diacetoxyscirpenol was found to occur in cereals conjugated to glucose and other sugars. | | Safety Profile | A deadly poison by ingestion,inhalation, intravenous, intraperitoneal, and subcutaneousroutes. Human systemic effects by intraperitoneal route:muscle weakness, nausea or vomiting, and fever. Anexperimental teratogen. Other experimental reproductiveef |
| | DIACETOXYSCIRPENOL Preparation Products And Raw materials |
|