|
|
| | Ropivacaine-ET-S-HCl Basic information |
| Product Name: | Ropivacaine-ET-S-HCl | | Synonyms: | Ropivacaine-007-S-HCl;Ropivacaine Impurity 4 HCl;Ropivacaine impurity 6/Ropivacaine EP Impurity D HCl/N-2-Desmethyl Ropivacaine HCl/(S)-N-(2,6-dimethylphenyl)-1-ethylpiperidine-2-carboxamide hydrochloride;(S)-N-(2,6-dimethylphenyl)-1-ethylpiperidine-2-carboxamide hydrochloride;Ropivacaine-ET-S-HCl;Ropivacaine EP Impurity C HCl | | CAS: | 112773-86-1 | | MF: | C16H25ClN2O | | MW: | 296.84 | | EINECS: | | | Product Categories: | | | Mol File: | 112773-86-1.mol |  |
| | Ropivacaine-ET-S-HCl Chemical Properties |
| InChI | InChI=1/C16H24N2O.ClH/c1-4-18-11-6-5-10-14(18)16(19)17-15-12(2)8-7-9-13(15)3;/h7-9,14H,4-6,10-11H2,1-3H3,(H,17,19);1H/t14-;/s3 | | InChIKey | KBWCDPIKVZMWRX-XOIICWPPNA-N | | SMILES | C([C@@H]1CCCCN1CC)(=O)NC1C(=CC=CC=1C)C.Cl |&1:1,r| |
| | Ropivacaine-ET-S-HCl Usage And Synthesis |
| | Ropivacaine-ET-S-HCl Preparation Products And Raw materials |
|