| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
PF-06767832 manufacturers
- PF-06767832
-
- $1520.00
-
2026-05-11
- CAS:1859081-58-5
- Purity:
- Supply Ability: 10g
|
| | PF-06767832 Basic information |
| Product Name: | PF-06767832 | | Synonyms: | PF-06767832;N-((3R,4S)-3-HYDROXYTETRAHYDRO-2H-PYRAN-4-YL)-5-METHYL-4-(4-(THIAZOL-4-YL)BENZYL)PICOLINAMIDE;L-threo-Pentitol, 1,5-anhydro-2,3-dideoxy-3-[[[5-methyl-4-[[4-(4-thiazolyl)phenyl]methyl]-2-pyridinyl]carbonyl]amino]-;PF-06767832 >=98% (HPLC);PF 6767832;PF6767832;PF-6767832 | | CAS: | 1859081-58-5 | | MF: | C22H23N3O3S | | MW: | 409.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1859081-58-5.mol |  |
| | PF-06767832 Chemical Properties |
| Boiling point | 666.5±55.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: 30mg/mL, clear | | form | powder | | pka | 12.99±0.40(Predicted) | | color | white to beige | | InChIKey | VVZZHFMLRHJXTO-RXVVDRJESA-N | | SMILES | CC1=CN=C(C(N[C@@H]2[C@@H](O)COCC2)=O)C=C1CC3=CC=C(C4=CSC=N4)C=C3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | PF-06767832 Usage And Synthesis |
| Uses | PF-06767832 has been studied as a M1 muscarinic acetylcholine receptor agonist. | | Biochem/physiol Actions | PF-06767832 is a cell permeable, potent and selective M1 muscarinic acetylcholine receptor Positive Allosteric Modulator (PAM). Studies have shown that PF-06767832 potentiates the activity of acetylcholine (Ach) in vitro. |
| | PF-06767832 Preparation Products And Raw materials |
|